C17H29NO3 — CID 146231501
[(2E,6S)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] N-propan-2-ylcarbamate (PubChem CID 146231501) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is [(2E,6S)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] N-propan-2-ylcarbamate.
| Compound Name | [(2E,6S)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 146231501 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | [(2E,6S)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC1/C=C\CC[C@H](C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H29NO3/c1-12(2)18-16(20)21-14-9-7-6-8-13(10-11-14)15(19)17(3,4)5/h7,9,12-14H,6,8,10-11H2,1-5H3,(H,18,20)/b9-7-/t13-,14?/m0/s1 |
| InChIKey | NXTFPDYAFRBMSK-RSRMNXEQSA-N |
| XLogP | 3.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|