C15H27NO2 — CID 118053668
[(4E)-cyclooct-4-en-1-yl] N-(3,3-dimethylbutyl)carbamate (PubChem CID 118053668) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(4E)-cyclooct-4-en-1-yl] N-(3,3-dimethylbutyl)carbamate.
| Compound Name | [(4E)-cyclooct-4-en-1-yl] N-(3,3-dimethylbutyl)carbamate |
|---|---|
| PubChem CID | 118053668 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(4E)-cyclooct-4-en-1-yl] N-(3,3-dimethylbutyl)carbamate |
| SMILES | CC(C)(C)CCNC(=O)OC1CC/C=C\CCC1 |
| InChI | InChI=1S/C15H27NO2/c1-15(2,3)11-12-16-14(17)18-13-9-7-5-4-6-8-10-13/h4-5,13H,6-12H2,1-3H3,(H,16,17)/b5-4- |
| InChIKey | OBXVOPHMOLRDMO-PLNGDYQASA-N |
| XLogP | 4.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|