C10H18N2O2 — CID 138548914
[(4E)-cyclooct-4-en-1-yl] N-(aminomethyl)carbamate (PubChem CID 138548914) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is [(4E)-cyclooct-4-en-1-yl] N-(aminomethyl)carbamate.
| Compound Name | [(4E)-cyclooct-4-en-1-yl] N-(aminomethyl)carbamate |
|---|---|
| PubChem CID | 138548914 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(4E)-cyclooct-4-en-1-yl] N-(aminomethyl)carbamate |
| SMILES | NCNC(=O)OC1CC/C=C\CCC1 |
| InChI | InChI=1S/C10H18N2O2/c11-8-12-10(13)14-9-6-4-2-1-3-5-7-9/h1-2,9H,3-8,11H2,(H,12,13)/b2-1- |
| InChIKey | MMFACMRJQOHHPW-UPHRSURJSA-N |
| XLogP | 1.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|