C16H31N3O3 — CID 171825168
[(4E)-cyclooct-4-en-1-yl] N-[3-(2-hydrazinylethoxy)-2,2-dimethylpropyl]carbamate (PubChem CID 171825168) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is [(4E)-cyclooct-4-en-1-yl] N-[3-(2-hydrazinylethoxy)-2,2-dimethylpropyl]carbamate.
| Compound Name | [(4E)-cyclooct-4-en-1-yl] N-[3-(2-hydrazinylethoxy)-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 171825168 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | [(4E)-cyclooct-4-en-1-yl] N-[3-(2-hydrazinylethoxy)-2,2-dimethylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC1CC/C=C\CCC1)COCCNN |
| InChI | InChI=1S/C16H31N3O3/c1-16(2,13-21-11-10-19-17)12-18-15(20)22-14-8-6-4-3-5-7-9-14/h3-4,14,19H,5-13,17H2,1-2H3,(H,18,20)/b4-3- |
| InChIKey | DDBTWMYFBRGASF-ARJAWSKDSA-N |
| XLogP | 2.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|