C23H44N2O5 — CID 172513179
[(4Z)-cyclooct-4-en-1-yl] N-[3-[2-[2-[3-(diethylamino)propoxy]ethoxy]ethoxy]propyl]carbamate (PubChem CID 172513179) has the molecular formula C23H44N2O5 and a molecular weight of 428.61 g/mol. Its IUPAC name is [(4Z)-cyclooct-4-en-1-yl] N-[3-[2-[2-[3-(diethylamino)propoxy]ethoxy]ethoxy]propyl]carbamate.
| Compound Name | [(4Z)-cyclooct-4-en-1-yl] N-[3-[2-[2-[3-(diethylamino)propoxy]ethoxy]ethoxy]propyl]carbamate |
|---|---|
| PubChem CID | 172513179 |
| Molecular Formula | C23H44N2O5 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | [(4Z)-cyclooct-4-en-1-yl] N-[3-[2-[2-[3-(diethylamino)propoxy]ethoxy]ethoxy]propyl]carbamate |
| SMILES | CCN(CC)CCCOCCOCCOCCCNC(=O)OC1CC/C=C\CCC1 |
| InChI | InChI=1S/C23H44N2O5/c1-3-25(4-2)15-11-17-28-19-21-29-20-18-27-16-10-14-24-23(26)30-22-12-8-6-5-7-9-13-22/h5-6,22H,3-4,7-21H2,1-2H3,(H,24,26)/b6-5- |
| InChIKey | UEMRZGAMTQVTTM-WAYWQWQTSA-N |
| XLogP | 3.77 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|