C60H108N2O11 — CID 176948506
[2-[3-[3-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]propyl-ethylamino]propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 176948506) has the molecular formula C60H108N2O11 and a molecular weight of 1033.53 g/mol. Its IUPAC name is [2-[3-[3-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]propyl-ethylamino]propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[3-[3-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]propyl-ethylamino]propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 176948506 |
| Molecular Formula | C60H108N2O11 |
| Molecular Weight | 1033.53 g/mol |
| Exact Mass | 1032.80 |
| IUPAC Name | [2-[3-[3-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]propyl-ethylamino]propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)COC(=O)OCCCN(CC)CCCNC(=O)OC1CC/C=C\CCC1 |
| InChI | InChI=1S/C60H108N2O11/c1-5-9-12-15-18-19-20-21-22-23-24-25-26-30-35-42-56(63)70-51-54(52-71-57(64)43-44-58(67-48-36-31-16-13-10-6-2)68-49-37-32-17-14-11-7-3)53-72-60(66)69-50-39-47-62(8-4)46-38-45-61-59(65)73-55-40-33-28-27-29-34-41-55/h18-19,21-22,27-28,54-55,58H,5-17,20,23-26,29-53H2,1-4H3,(H,61,65)/b19-18-,22-21-,28-27- |
| InChIKey | DWJPKLNKBBTKKJ-HPABCENFSA-N |
| XLogP | 15.23 |
| TPSA | 148.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.53 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|