C15H26NO4PS — CID 170791902
6-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]hexoxy-oxo-sulfidophosphanium (PubChem CID 170791902) has the molecular formula C15H26NO4PS and a molecular weight of 347.42 g/mol. Its IUPAC name is 6-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]hexoxy-oxo-sulfidophosphanium.
| Compound Name | 6-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]hexoxy-oxo-sulfidophosphanium |
|---|---|
| PubChem CID | 170791902 |
| Molecular Formula | C15H26NO4PS |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 6-[[(4E)-cyclooct-4-en-1-yl]oxycarbonylamino]hexoxy-oxo-sulfidophosphanium |
| SMILES | O=C(NCCCCCCO[P+](=O)[S-])OC1CC/C=C\CCC1 |
| InChI | InChI=1S/C15H26NO4PS/c17-15(20-14-10-6-2-1-3-7-11-14)16-12-8-4-5-9-13-19-21(18)22/h1-2,14H,3-13H2,(H,16,17)/b2-1- |
| InChIKey | PBHXLPPIVHVTRY-UPHRSURJSA-N |
| XLogP | 4.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|