C12H22N2O2 — CID 123295112
N-(2-aminoethyl)-2-cyclooct-4-en-1-yloxyacetamide (PubChem CID 123295112) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-cyclooct-4-en-1-yloxyacetamide.
| Compound Name | N-(2-aminoethyl)-2-cyclooct-4-en-1-yloxyacetamide |
|---|---|
| PubChem CID | 123295112 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-(2-aminoethyl)-2-cyclooct-4-en-1-yloxyacetamide |
| SMILES | NCCNC(=O)COC1CCC=CCCC1 |
| InChI | InChI=1S/C12H22N2O2/c13-8-9-14-12(15)10-16-11-6-4-2-1-3-5-7-11/h1-2,11H,3-10,13H2,(H,14,15) |
| InChIKey | FPVJURXRNKKHLU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|