C16H32NO6PY — CID 178169246
6-[(2-cyclooctyloxyacetyl)amino]hexyl dihydrogen phosphate;yttrium (PubChem CID 178169246) has the molecular formula C16H32NO6PY and a molecular weight of 454.31 g/mol. Its IUPAC name is 6-[(2-cyclooctyloxyacetyl)amino]hexyl dihydrogen phosphate;yttrium.
| Compound Name | 6-[(2-cyclooctyloxyacetyl)amino]hexyl dihydrogen phosphate;yttrium |
|---|---|
| PubChem CID | 178169246 |
| Molecular Formula | C16H32NO6PY |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 6-[(2-cyclooctyloxyacetyl)amino]hexyl dihydrogen phosphate;yttrium |
| SMILES | O=C(COC1CCCCCCC1)NCCCCCCOP(=O)(O)O.[Y] |
| InChI | InChI=1S/C16H32NO6P.Y/c18-16(14-22-15-10-6-2-1-3-7-11-15)17-12-8-4-5-9-13-23-24(19,20)21;/h15H,1-14H2,(H,17,18)(H2,19,20,21); |
| InChIKey | BZRQLWGVZDPWMA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|