C14H29N2O7P — CID 118012875
6-[[5-(2-methoxyethylamino)-5-oxopentanoyl]amino]hexyl dihydrogen phosphate (PubChem CID 118012875) has the molecular formula C14H29N2O7P and a molecular weight of 368.37 g/mol. Its IUPAC name is 6-[[5-(2-methoxyethylamino)-5-oxopentanoyl]amino]hexyl dihydrogen phosphate.
| Compound Name | 6-[[5-(2-methoxyethylamino)-5-oxopentanoyl]amino]hexyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118012875 |
| Molecular Formula | C14H29N2O7P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 6-[[5-(2-methoxyethylamino)-5-oxopentanoyl]amino]hexyl dihydrogen phosphate |
| SMILES | COCCNC(=O)CCCC(=O)NCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C14H29N2O7P/c1-22-12-10-16-14(18)8-6-7-13(17)15-9-4-2-3-5-11-23-24(19,20)21/h2-12H2,1H3,(H,15,17)(H,16,18)(H2,19,20,21) |
| InChIKey | YYEHAUYKOFUTDQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|