C13H26NO5P — CID 10380486
2-(undec-10-enoylamino)ethyl dihydrogen phosphate (PubChem CID 10380486) has the molecular formula C13H26NO5P and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-(undec-10-enoylamino)ethyl dihydrogen phosphate.
| Compound Name | 2-(undec-10-enoylamino)ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10380486 |
| Molecular Formula | C13H26NO5P |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-(undec-10-enoylamino)ethyl dihydrogen phosphate |
| SMILES | C=CCCCCCCCCC(=O)NCCOP(=O)(O)O |
| InChI | InChI=1S/C13H26NO5P/c1-2-3-4-5-6-7-8-9-10-13(15)14-11-12-19-20(16,17)18/h2H,1,3-12H2,(H,14,15)(H2,16,17,18) |
| InChIKey | ORAPBJSIDIBMGA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|