C32H60N2O4 — CID 71392102
N-[3-[4-[3-(undec-10-enoylamino)propoxy]butoxy]propyl]undec-10-enamide (PubChem CID 71392102) has the molecular formula C32H60N2O4 and a molecular weight of 536.84 g/mol. Its IUPAC name is N-[3-[4-[3-(undec-10-enoylamino)propoxy]butoxy]propyl]undec-10-enamide.
| Compound Name | N-[3-[4-[3-(undec-10-enoylamino)propoxy]butoxy]propyl]undec-10-enamide |
|---|---|
| PubChem CID | 71392102 |
| Molecular Formula | C32H60N2O4 |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 536.46 |
| IUPAC Name | N-[3-[4-[3-(undec-10-enoylamino)propoxy]butoxy]propyl]undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)NCCCOCCCCOCCCNC(=O)CCCCCCCCC=C |
| InChI | InChI=1S/C32H60N2O4/c1-3-5-7-9-11-13-15-17-23-31(35)33-25-21-29-37-27-19-20-28-38-30-22-26-34-32(36)24-18-16-14-12-10-8-6-4-2/h3-4H,1-2,5-30H2,(H,33,35)(H,34,36) |
| InChIKey | YVOZKEKAOKRNEI-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|