C28H52N2O3 — CID 151761639
N-[3-[3-(undec-10-enoylamino)propoxy]propyl]undec-10-enamide (PubChem CID 151761639) has the molecular formula C28H52N2O3 and a molecular weight of 464.74 g/mol. Its IUPAC name is N-[3-[3-(undec-10-enoylamino)propoxy]propyl]undec-10-enamide.
| Compound Name | N-[3-[3-(undec-10-enoylamino)propoxy]propyl]undec-10-enamide |
|---|---|
| PubChem CID | 151761639 |
| Molecular Formula | C28H52N2O3 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.40 |
| IUPAC Name | N-[3-[3-(undec-10-enoylamino)propoxy]propyl]undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)NCCCOCCCNC(=O)CCCCCCCCC=C |
| InChI | InChI=1S/C28H52N2O3/c1-3-5-7-9-11-13-15-17-21-27(31)29-23-19-25-33-26-20-24-30-28(32)22-18-16-14-12-10-8-6-4-2/h3-4H,1-2,5-26H2,(H,29,31)(H,30,32) |
| InChIKey | RQRLROUGESZMES-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|