C30H58N4O2 — CID 59864047
N-[3-[2-[3-(undec-10-enoylamino)propylamino]ethylamino]propyl]undec-10-enamide (PubChem CID 59864047) has the molecular formula C30H58N4O2 and a molecular weight of 506.82 g/mol. Its IUPAC name is N-[3-[2-[3-(undec-10-enoylamino)propylamino]ethylamino]propyl]undec-10-enamide.
| Compound Name | N-[3-[2-[3-(undec-10-enoylamino)propylamino]ethylamino]propyl]undec-10-enamide |
|---|---|
| PubChem CID | 59864047 |
| Molecular Formula | C30H58N4O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.46 |
| IUPAC Name | N-[3-[2-[3-(undec-10-enoylamino)propylamino]ethylamino]propyl]undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)NCCCNCCNCCCNC(=O)CCCCCCCCC=C |
| InChI | InChI=1S/C30H58N4O2/c1-3-5-7-9-11-13-15-17-21-29(35)33-25-19-23-31-27-28-32-24-20-26-34-30(36)22-18-16-14-12-10-8-6-4-2/h3-4,31-32H,1-2,5-28H2,(H,33,35)(H,34,36) |
| InChIKey | KUVNZSPDZULPCD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|