C16H29N3OS — CID 141055788
N-[2-(ethylidenecarbamothioylamino)ethyl]undec-10-enamide (PubChem CID 141055788) has the molecular formula C16H29N3OS and a molecular weight of 311.50 g/mol. Its IUPAC name is N-[2-(ethylidenecarbamothioylamino)ethyl]undec-10-enamide.
| Compound Name | N-[2-(ethylidenecarbamothioylamino)ethyl]undec-10-enamide |
|---|---|
| PubChem CID | 141055788 |
| Molecular Formula | C16H29N3OS |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[2-(ethylidenecarbamothioylamino)ethyl]undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)NCCNC(=S)N=CC |
| InChI | InChI=1S/C16H29N3OS/c1-3-5-6-7-8-9-10-11-12-15(20)18-13-14-19-16(21)17-4-2/h3-4H,1,5-14H2,2H3,(H,18,20)(H,19,21) |
| InChIKey | MCHDOYPADWFJIH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|