C20H38N3O2+ — CID 102117908
dimethyl-bis[(oct-7-enoylamino)methyl]azanium (PubChem CID 102117908) has the molecular formula C20H38N3O2+ and a molecular weight of 352.54 g/mol. Its IUPAC name is dimethyl-bis[(oct-7-enoylamino)methyl]azanium.
| Compound Name | dimethyl-bis[(oct-7-enoylamino)methyl]azanium |
|---|---|
| PubChem CID | 102117908 |
| Molecular Formula | C20H38N3O2+ |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | dimethyl-bis[(oct-7-enoylamino)methyl]azanium |
| SMILES | C=CCCCCCC(=O)NC[N+](C)(C)CNC(=O)CCCCCC=C |
| InChI | InChI=1S/C20H37N3O2/c1-5-7-9-11-13-15-19(24)21-17-23(3,4)18-22-20(25)16-14-12-10-8-6-2/h5-6H,1-2,7-18H2,3-4H3,(H-,21,22,24,25)/p+1 |
| InChIKey | TXUVTTDZFGULPG-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|