C25H46N2O3 — CID 156612713
N-[2-hydroxy-3-(undec-10-enoylamino)propyl]undec-10-enamide (PubChem CID 156612713) has the molecular formula C25H46N2O3 and a molecular weight of 422.65 g/mol. Its IUPAC name is N-[2-hydroxy-3-(undec-10-enoylamino)propyl]undec-10-enamide.
| Compound Name | N-[2-hydroxy-3-(undec-10-enoylamino)propyl]undec-10-enamide |
|---|---|
| PubChem CID | 156612713 |
| Molecular Formula | C25H46N2O3 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | N-[2-hydroxy-3-(undec-10-enoylamino)propyl]undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)NCC(O)CNC(=O)CCCCCCCCC=C |
| InChI | InChI=1S/C25H46N2O3/c1-3-5-7-9-11-13-15-17-19-24(29)26-21-23(28)22-27-25(30)20-18-16-14-12-10-8-6-4-2/h3-4,23,28H,1-2,5-22H2,(H,26,29)(H,27,30) |
| InChIKey | NOXCHROVMJXXDV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|