C15H28N2O3 — CID 137383448
N-[2-[(4-hydroxy-3,3-dimethylbutanoyl)amino]ethyl]hept-6-enamide (PubChem CID 137383448) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[2-[(4-hydroxy-3,3-dimethylbutanoyl)amino]ethyl]hept-6-enamide.
| Compound Name | N-[2-[(4-hydroxy-3,3-dimethylbutanoyl)amino]ethyl]hept-6-enamide |
|---|---|
| PubChem CID | 137383448 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | N-[2-[(4-hydroxy-3,3-dimethylbutanoyl)amino]ethyl]hept-6-enamide |
| SMILES | C=CCCCCC(=O)NCCNC(=O)CC(C)(C)CO |
| InChI | InChI=1S/C15H28N2O3/c1-4-5-6-7-8-13(19)16-9-10-17-14(20)11-15(2,3)12-18/h4,18H,1,5-12H2,2-3H3,(H,16,19)(H,17,20) |
| InChIKey | HNJANIRFADOOCQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|