C13H27N3O3S2 — CID 138497832
N-[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]-4-hydroxy-3,3-dimethylbutanamide (PubChem CID 138497832) has the molecular formula C13H27N3O3S2 and a molecular weight of 337.51 g/mol. Its IUPAC name is N-[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]-4-hydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]-4-hydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 138497832 |
| Molecular Formula | C13H27N3O3S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]-4-hydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)CC(=O)NCCC(=O)NCCSSCCN |
| InChI | InChI=1S/C13H27N3O3S2/c1-13(2,10-17)9-12(19)15-5-3-11(18)16-6-8-21-20-7-4-14/h17H,3-10,14H2,1-2H3,(H,15,19)(H,16,18) |
| InChIKey | PQJNUSYAGNBISR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|