C14H29N3O4S2 — CID 138497966
N-[2-(2-aminoethyldisulfanyl)ethyl]-3-[[(2R)-2-formyl-2,4-dihydroxy-3,3-dimethylbutyl]amino]propanamide (PubChem CID 138497966) has the molecular formula C14H29N3O4S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-3-[[(2R)-2-formyl-2,4-dihydroxy-3,3-dimethylbutyl]amino]propanamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3-[[(2R)-2-formyl-2,4-dihydroxy-3,3-dimethylbutyl]amino]propanamide |
|---|---|
| PubChem CID | 138497966 |
| Molecular Formula | C14H29N3O4S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3-[[(2R)-2-formyl-2,4-dihydroxy-3,3-dimethylbutyl]amino]propanamide |
| SMILES | CC(C)(CO)[C@](O)(C=O)CNCCC(=O)NCCSSCCN |
| InChI | InChI=1S/C14H29N3O4S2/c1-13(2,10-18)14(21,11-19)9-16-5-3-12(20)17-6-8-23-22-7-4-15/h11,16,18,21H,3-10,15H2,1-2H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | APOHVGBDGBLKLA-CQSZACIVSA-N |
| XLogP | -0.63 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|