About 9-phosphonooxynonyl dihydrogen phosphate
9-phosphonooxynonyl dihydrogen phosphate (PubChem CID 142711404) has the molecular formula C9H22O8P2
and a molecular weight of 320.22 g/mol. Its IUPAC name is 9-phosphonooxynonyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 9-phosphonooxynonyl dihydrogen phosphate |
| PubChem CID | 142711404 |
| Molecular Formula | C9H22O8P2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 9-phosphonooxynonyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCCCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C9H22O8P2/c10-18(11,12)16-8-6-4-2-1-3-5-7-9-17-19(13,14)15/h1-9H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | BNWVQNIUTNGBAV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9-phosphonooxynonyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phosphonooxynonyl dihydrogen phosphate?
The IUPAC name of 9-phosphonooxynonyl dihydrogen phosphate (CID 142711404) is 9-phosphonooxynonyl dihydrogen phosphate.
What is the SMILES notation for 9-phosphonooxynonyl dihydrogen phosphate?
The canonical SMILES for 9-phosphonooxynonyl dihydrogen phosphate is O=P(O)(O)OCCCCCCCCCOP(=O)(O)O.
What is the InChIKey of 9-phosphonooxynonyl dihydrogen phosphate?
The InChIKey is BNWVQNIUTNGBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O8P2/c10-18(11,12)16-8-6-4-2-1-3-5-7-9-17-19(13,14)15/h1-9H2,(H2,10,11,12)(H2,13,14,15).
What are the key properties of 9-phosphonooxynonyl dihydrogen phosphate?
9-phosphonooxynonyl dihydrogen phosphate has a molecular weight of 320.22 g/mol, XLogP of 1.94, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phosphonooxynonyl dihydrogen phosphate is sourced from PubChem (CID 142711404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).