About 10-phosphonooxydecyl dihydrogen phosphate
10-phosphonooxydecyl dihydrogen phosphate (PubChem CID 19764276) has the molecular formula C10H24O8P2
and a molecular weight of 334.24 g/mol. Its IUPAC name is 10-phosphonooxydecyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 10-phosphonooxydecyl dihydrogen phosphate |
| PubChem CID | 19764276 |
| Molecular Formula | C10H24O8P2 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 10-phosphonooxydecyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCCCCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C10H24O8P2/c11-19(12,13)17-9-7-5-3-1-2-4-6-8-10-18-20(14,15)16/h1-10H2,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | RDQVRMLSWFDZJP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 10-phosphonooxydecyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-phosphonooxydecyl dihydrogen phosphate?
The IUPAC name of 10-phosphonooxydecyl dihydrogen phosphate (CID 19764276) is 10-phosphonooxydecyl dihydrogen phosphate.
What is the SMILES notation for 10-phosphonooxydecyl dihydrogen phosphate?
The canonical SMILES for 10-phosphonooxydecyl dihydrogen phosphate is O=P(O)(O)OCCCCCCCCCCOP(=O)(O)O.
What is the InChIKey of 10-phosphonooxydecyl dihydrogen phosphate?
The InChIKey is RDQVRMLSWFDZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24O8P2/c11-19(12,13)17-9-7-5-3-1-2-4-6-8-10-18-20(14,15)16/h1-10H2,(H2,11,12,13)(H2,14,15,16).
What are the key properties of 10-phosphonooxydecyl dihydrogen phosphate?
10-phosphonooxydecyl dihydrogen phosphate has a molecular weight of 334.24 g/mol, XLogP of 2.33, 13 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-phosphonooxydecyl dihydrogen phosphate is sourced from PubChem (CID 19764276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).