C14H25NO3 — CID 118550746
[(2E)-5-(tert-butylamino)cyclooct-2-en-1-yl] methyl carbonate (PubChem CID 118550746) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is [(2E)-5-(tert-butylamino)cyclooct-2-en-1-yl] methyl carbonate.
| Compound Name | [(2E)-5-(tert-butylamino)cyclooct-2-en-1-yl] methyl carbonate |
|---|---|
| PubChem CID | 118550746 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | [(2E)-5-(tert-butylamino)cyclooct-2-en-1-yl] methyl carbonate |
| SMILES | COC(=O)OC1/C=C\CC(NC(C)(C)C)CCC1 |
| InChI | InChI=1S/C14H25NO3/c1-14(2,3)15-11-7-5-9-12(10-6-8-11)18-13(16)17-4/h5,9,11-12,15H,6-8,10H2,1-4H3/b9-5- |
| InChIKey | ZCOHPALAIBFQNX-UITAMQMPSA-N |
| XLogP | 3.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|