C11H16O5 — CID 90182967
(3E)-5-methoxycarbonyloxycyclooct-3-ene-1-carboxylic acid (PubChem CID 90182967) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (3E)-5-methoxycarbonyloxycyclooct-3-ene-1-carboxylic acid.
| Compound Name | (3E)-5-methoxycarbonyloxycyclooct-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 90182967 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3E)-5-methoxycarbonyloxycyclooct-3-ene-1-carboxylic acid |
| SMILES | COC(=O)OC1/C=C\CC(C(=O)O)CCC1 |
| InChI | InChI=1S/C11H16O5/c1-15-11(14)16-9-6-2-4-8(10(12)13)5-3-7-9/h2,6,8-9H,3-5,7H2,1H3,(H,12,13)/b6-2- |
| InChIKey | CTYIEFKMOQIXTL-KXFIGUGUSA-N |
| XLogP | 1.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|