C11H17NO4 — CID 90183096
(3E)-5-(methylcarbamoyloxy)cyclooct-3-ene-1-carboxylic acid (PubChem CID 90183096) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (3E)-5-(methylcarbamoyloxy)cyclooct-3-ene-1-carboxylic acid.
| Compound Name | (3E)-5-(methylcarbamoyloxy)cyclooct-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 90183096 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (3E)-5-(methylcarbamoyloxy)cyclooct-3-ene-1-carboxylic acid |
| SMILES | CNC(=O)OC1/C=C\CC(C(=O)O)CCC1 |
| InChI | InChI=1S/C11H17NO4/c1-12-11(15)16-9-6-2-4-8(10(13)14)5-3-7-9/h2,6,8-9H,3-5,7H2,1H3,(H,12,15)(H,13,14)/b6-2- |
| InChIKey | SEANXCGSJVAZOB-KXFIGUGUSA-N |
| XLogP | 1.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|