C15H27NO4 — CID 118458921
[(6E)-2-tert-butyl-5,8-dihydro-4H-1,3-dioxocin-5-yl] N-tert-butylcarbamate (PubChem CID 118458921) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is [(6E)-2-tert-butyl-5,8-dihydro-4H-1,3-dioxocin-5-yl] N-tert-butylcarbamate.
| Compound Name | [(6E)-2-tert-butyl-5,8-dihydro-4H-1,3-dioxocin-5-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 118458921 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | [(6E)-2-tert-butyl-5,8-dihydro-4H-1,3-dioxocin-5-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1/C=C\COC(C(C)(C)C)OC1 |
| InChI | InChI=1S/C15H27NO4/c1-14(2,3)12-18-9-7-8-11(10-19-12)20-13(17)16-15(4,5)6/h7-8,11-12H,9-10H2,1-6H3,(H,16,17)/b8-7- |
| InChIKey | MHMRXWPKIHJMAR-FPLPWBNLSA-N |
| XLogP | 2.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|