C20H27F4N3O4 — CID 155745384
ethane;[(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]ethyl]carbamate (PubChem CID 155745384) has the molecular formula C20H27F4N3O4 and a molecular weight of 449.45 g/mol. Its IUPAC name is ethane;[(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]ethyl]carbamate.
| Compound Name | ethane;[(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 155745384 |
| Molecular Formula | C20H27F4N3O4 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | ethane;[(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]ethyl]carbamate |
| SMILES | CC.Nc1c(F)c(F)c(C(=O)NCCNC(=O)OC2/C=C\CCC(O)CC2)c(F)c1F |
| InChI | InChI=1S/C18H21F4N3O4.C2H6/c19-12-11(13(20)15(22)16(23)14(12)21)17(27)24-7-8-25-18(28)29-10-4-2-1-3-9(26)5-6-10;1-2/h2,4,9-10,26H,1,3,5-8,23H2,(H,24,27)(H,25,28);1-2H3/b4-2-; |
| InChIKey | DUKPZQXNBZXDBV-MKHFZPSSSA-N |
| XLogP | 3.17 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|