C19H29N3O5 — CID 155745336
[(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2-hydroxybenzoyl)amino]ethyl]carbamate;methane (PubChem CID 155745336) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is [(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2-hydroxybenzoyl)amino]ethyl]carbamate;methane.
| Compound Name | [(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2-hydroxybenzoyl)amino]ethyl]carbamate;methane |
|---|---|
| PubChem CID | 155745336 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [(2E)-6-hydroxycyclooct-2-en-1-yl] N-[2-[(4-amino-2-hydroxybenzoyl)amino]ethyl]carbamate;methane |
| SMILES | C.Nc1ccc(C(=O)NCCNC(=O)OC2/C=C\CCC(O)CC2)c(O)c1 |
| InChI | InChI=1S/C18H25N3O5.CH4/c19-12-5-8-15(16(23)11-12)17(24)20-9-10-21-18(25)26-14-4-2-1-3-13(22)6-7-14;/h2,4-5,8,11,13-14,22-23H,1,3,6-7,9-10,19H2,(H,20,24)(H,21,25);1H4/b4-2-; |
| InChIKey | VZEGRYYCUJZIAC-MKHFZPSSSA-N |
| XLogP | 1.93 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|