C11H13NO3 — CID 103739641
N-(cyclopropylmethyl)-2,4-dihydroxybenzamide (PubChem CID 103739641) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,4-dihydroxybenzamide.
| Compound Name | N-(cyclopropylmethyl)-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103739641 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-(cyclopropylmethyl)-2,4-dihydroxybenzamide |
| SMILES | O=C(NCC1CC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H13NO3/c13-8-3-4-9(10(14)5-8)11(15)12-6-7-1-2-7/h3-5,7,13-14H,1-2,6H2,(H,12,15) |
| InChIKey | ZBSQUOBFPQSLAS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |