C15H19NO3 — CID 103714393
N-(2,2-dicyclopropylethyl)-2,4-dihydroxybenzamide (PubChem CID 103714393) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(2,2-dicyclopropylethyl)-2,4-dihydroxybenzamide.
| Compound Name | N-(2,2-dicyclopropylethyl)-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103714393 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-(2,2-dicyclopropylethyl)-2,4-dihydroxybenzamide |
| SMILES | O=C(NCC(C1CC1)C1CC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H19NO3/c17-11-5-6-12(14(18)7-11)15(19)16-8-13(9-1-2-9)10-3-4-10/h5-7,9-10,13,17-18H,1-4,8H2,(H,16,19) |
| InChIKey | RJDSKWMVNBNEAN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |