C10H14N2O3 — CID 63733125
N-(2-aminopropyl)-2,4-dihydroxybenzamide (PubChem CID 63733125) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is N-(2-aminopropyl)-2,4-dihydroxybenzamide.
| Compound Name | N-(2-aminopropyl)-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 63733125 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N-(2-aminopropyl)-2,4-dihydroxybenzamide |
| SMILES | CC(N)CNC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H14N2O3/c1-6(11)5-12-10(15)8-3-2-7(13)4-9(8)14/h2-4,6,13-14H,5,11H2,1H3,(H,12,15) |
| InChIKey | MLIDYBWFXFAUFU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |