C10H11NO3 — CID 103608413
2,4-dihydroxy-N-prop-2-enylbenzamide (PubChem CID 103608413) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 2,4-dihydroxy-N-prop-2-enylbenzamide.
| Compound Name | 2,4-dihydroxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 103608413 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2,4-dihydroxy-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H11NO3/c1-2-5-11-10(14)8-4-3-7(12)6-9(8)13/h2-4,6,12-13H,1,5H2,(H,11,14) |
| InChIKey | UACJSNUHHVMEBQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|