C12H13NO5 — CID 2645392
[2-oxo-2-(prop-2-enylamino)ethyl] 2,4-dihydroxybenzoate (PubChem CID 2645392) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 2645392 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2,4-dihydroxybenzoate |
| SMILES | C=CCNC(=O)COC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C12H13NO5/c1-2-5-13-11(16)7-18-12(17)9-4-3-8(14)6-10(9)15/h2-4,6,14-15H,1,5,7H2,(H,13,16) |
| InChIKey | JSADUZUUKRQNSG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|