C18H25NO4 — CID 2531107
[2-oxo-2-(prop-2-enylamino)ethyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate (PubChem CID 2531107) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate |
|---|---|
| PubChem CID | 2531107 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate |
| SMILES | C=CCNC(=O)COC(=O)c1cc(C(C)C)cc(C(C)C)c1O |
| InChI | InChI=1S/C18H25NO4/c1-6-7-19-16(20)10-23-18(22)15-9-13(11(2)3)8-14(12(4)5)17(15)21/h6,8-9,11-12,21H,1,7,10H2,2-5H3,(H,19,20) |
| InChIKey | CIJKVEBPDBMVSP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|