C19H24N2O4 — CID 7983461
[(3R)-3-cyano-4-imino-2-oxopentyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate (PubChem CID 7983461) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate |
|---|---|
| PubChem CID | 7983461 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2-hydroxy-3,5-di(propan-2-yl)benzoate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)c1cc(C(C)C)cc(C(C)C)c1O |
| InChI | InChI=1S/C19H24N2O4/c1-10(2)13-6-14(11(3)4)18(23)15(7-13)19(24)25-9-17(22)16(8-20)12(5)21/h6-7,10-11,16,21,23H,9H2,1-5H3/b21-12+/t16-/m0/s1 |
| InChIKey | POSZWIYCDITAMA-GKXUUXLPSA-N |
| XLogP | 3.54 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|