C16H13BrN2O6 — CID 7870754
[2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 7870754) has the molecular formula C16H13BrN2O6 and a molecular weight of 409.19 g/mol. Its IUPAC name is [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 7870754 |
| Molecular Formula | C16H13BrN2O6 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | [2-[2-(2-bromobenzoyl)hydrazinyl]-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1O)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C16H13BrN2O6/c17-12-4-2-1-3-10(12)15(23)19-18-14(22)8-25-16(24)11-6-5-9(20)7-13(11)21/h1-7,20-21H,8H2,(H,18,22)(H,19,23) |
| InChIKey | FIIDNZSCDLRROM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|