C15H11FO5 — CID 7501091
[2-(2-fluorophenyl)-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 7501091) has the molecular formula C15H11FO5 and a molecular weight of 290.25 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 7501091 |
| Molecular Formula | C15H11FO5 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(OCC(=O)c1ccccc1F)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H11FO5/c16-12-4-2-1-3-10(12)14(19)8-21-15(20)11-6-5-9(17)7-13(11)18/h1-7,17-18H,8H2 |
| InChIKey | HMEPKRSOQLEMAK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |