C16H12F2O5 — CID 17448025
[2-(2,4-difluorophenyl)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate (PubChem CID 17448025) has the molecular formula C16H12F2O5 and a molecular weight of 322.26 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate.
| Compound Name | [2-(2,4-difluorophenyl)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 17448025 |
| Molecular Formula | C16H12F2O5 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [2-(2,4-difluorophenyl)-2-oxoethyl] 2-hydroxy-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc(F)cc2F)c(O)c1 |
| InChI | InChI=1S/C16H12F2O5/c1-22-10-3-5-12(14(19)7-10)16(21)23-8-15(20)11-4-2-9(17)6-13(11)18/h2-7,19H,8H2,1H3 |
| InChIKey | YWQNOXPTRHHTRP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |