C13H11NO5 — CID 7870759
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 2,4-dihydroxybenzoate (PubChem CID 7870759) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 7870759 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1O)c1ccc[nH]1 |
| InChI | InChI=1S/C13H11NO5/c15-8-3-4-9(11(16)6-8)13(18)19-7-12(17)10-2-1-5-14-10/h1-6,14-16H,7H2 |
| InChIKey | XKWAKMPPGHLXIC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |