C16H29Cl2NOSiTi-2 — CID 59110802
[[(1R)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-dimethylsilyl]-tert-butylazanide;carbanide;dichlorotitanium (PubChem CID 59110802) has the molecular formula C16H29Cl2NOSiTi-2 and a molecular weight of 398.27 g/mol. Its IUPAC name is [[(1R)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-dimethylsilyl]-tert-butylazanide;carbanide;dichlorotitanium.
| Compound Name | [[(1R)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-dimethylsilyl]-tert-butylazanide;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 59110802 |
| Molecular Formula | C16H29Cl2NOSiTi-2 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [[(1R)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-dimethylsilyl]-tert-butylazanide;carbanide;dichlorotitanium |
| SMILES | CC(C)(C)[N-][Si](C)(C)O[C@@H]1CCC2C=CC=CC21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C15H26NOSi.CH3.2ClH.Ti/c1-15(2,3)16-18(4,5)17-14-11-10-12-8-6-7-9-13(12)14;;;;/h6-9,12-14H,10-11H2,1-5H3;1H3;2*1H;/q2*-1;;;+2/p-2/t12?,13?,14-;;;;/m1..../s1 |
| InChIKey | AIRMPWIXXHCRQS-XILDNEIGSA-L |
| XLogP | 6.22 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|