C21H34Cl2Ti-2 — CID 59962321
carbanide;dichlorotitanium;(1R)-1-[(1S)-1-[(1S,3R)-2,3,4,5-tetramethylcyclopentyl]ethyl]-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 59962321) has the molecular formula C21H34Cl2Ti-2 and a molecular weight of 405.28 g/mol. Its IUPAC name is carbanide;dichlorotitanium;(1R)-1-[(1S)-1-[(1S,3R)-2,3,4,5-tetramethylcyclopentyl]ethyl]-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | carbanide;dichlorotitanium;(1R)-1-[(1S)-1-[(1S,3R)-2,3,4,5-tetramethylcyclopentyl]ethyl]-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 59962321 |
| Molecular Formula | C21H34Cl2Ti-2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | carbanide;dichlorotitanium;(1R)-1-[(1S)-1-[(1S,3R)-2,3,4,5-tetramethylcyclopentyl]ethyl]-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | C[C-]1C(C)[C@H]([C@@H](C)[C@H]2CCC3C=CC=CC32)C(C)[C@@H]1C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C20H31.CH3.2ClH.Ti/c1-12-13(2)15(4)20(14(12)3)16(5)18-11-10-17-8-6-7-9-19(17)18;;;;/h6-9,12,14-20H,10-11H2,1-5H3;1H3;2*1H;/q2*-1;;;+2/p-2/t12-,14?,15?,16+,17?,18-,19?,20-;;;;/m1..../s1 |
| InChIKey | OKAFBARIBVDVGK-QLKAZZHYSA-L |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|