C20H34Si — CID 164724338
2,3,3a,7a-tetrahydro-1H-inden-1-yl-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane (PubChem CID 164724338) has the molecular formula C20H34Si and a molecular weight of 302.58 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-inden-1-yl-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yl-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane |
|---|---|
| PubChem CID | 164724338 |
| Molecular Formula | C20H34Si |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yl-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane |
| SMILES | CC1C(C)C(C)C([Si](C)(C)C2CCC3C=CC=CC32)C1C |
| InChI | InChI=1S/C20H34Si/c1-13-14(2)16(4)20(15(13)3)21(5,6)19-12-11-17-9-7-8-10-18(17)19/h7-10,13-20H,11-12H2,1-6H3 |
| InChIKey | ATICHIXTYFXMBJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|