C14H24Cl2NOSiZr+ — CID 23229521
[2,3,3a,7a-tetrahydro-1H-inden-1-yl(dimethyl)silyl]-(2-methoxyethyl)azanide;dichlorozirconium(2+) (PubChem CID 23229521) has the molecular formula C14H24Cl2NOSiZr+ and a molecular weight of 412.57 g/mol. Its IUPAC name is [2,3,3a,7a-tetrahydro-1H-inden-1-yl(dimethyl)silyl]-(2-methoxyethyl)azanide;dichlorozirconium(2+).
| Compound Name | [2,3,3a,7a-tetrahydro-1H-inden-1-yl(dimethyl)silyl]-(2-methoxyethyl)azanide;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 23229521 |
| Molecular Formula | C14H24Cl2NOSiZr+ |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | [2,3,3a,7a-tetrahydro-1H-inden-1-yl(dimethyl)silyl]-(2-methoxyethyl)azanide;dichlorozirconium(2+) |
| SMILES | COCC[N-][Si](C)(C)C1CCC2C=CC=CC21.Cl[Zr+2]Cl |
| InChI | InChI=1S/C14H24NOSi.2ClH.Zr/c1-16-11-10-15-17(2,3)14-9-8-12-6-4-5-7-13(12)14;;;/h4-7,12-14H,8-11H2,1-3H3;2*1H;/q-1;;;+4/p-2 |
| InChIKey | ZNBOHEXIWMWGRS-UHFFFAOYSA-L |
| XLogP | 5.11 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|