C33H52Si — CID 59985902
[(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-cyclohexyl-nonylsilane (PubChem CID 59985902) has the molecular formula C33H52Si and a molecular weight of 476.87 g/mol. Its IUPAC name is [(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-cyclohexyl-nonylsilane.
| Compound Name | [(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-cyclohexyl-nonylsilane |
|---|---|
| PubChem CID | 59985902 |
| Molecular Formula | C33H52Si |
| Molecular Weight | 476.87 g/mol |
| Exact Mass | 476.38 |
| IUPAC Name | [(1S)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-cyclohexyl-nonylsilane |
| SMILES | CCCCCCCCC[Si](C1CCCCC1)(C1CCC2C=CC=CC21)[C@H]1CCC2C=CC=CC21 |
| InChI | InChI=1S/C33H52Si/c1-2-3-4-5-6-7-15-26-34(29-18-9-8-10-19-29,32-24-22-27-16-11-13-20-30(27)32)33-25-23-28-17-12-14-21-31(28)33/h11-14,16-17,20-21,27-33H,2-10,15,18-19,22-26H2,1H3/t27?,28?,30?,31?,32-,33?,34?/m0/s1 |
| InChIKey | NJBOFZZCDIRQFR-MJRKIHDRSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.87 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|