C13H22LiO+ — CID 162289523
lithium;1-methoxy-2,3,3a,7a-tetrahydro-1H-indene;propane (PubChem CID 162289523) has the molecular formula C13H22LiO+ and a molecular weight of 201.26 g/mol. Its IUPAC name is lithium;1-methoxy-2,3,3a,7a-tetrahydro-1H-indene;propane.
| Compound Name | lithium;1-methoxy-2,3,3a,7a-tetrahydro-1H-indene;propane |
|---|---|
| PubChem CID | 162289523 |
| Molecular Formula | C13H22LiO+ |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | lithium;1-methoxy-2,3,3a,7a-tetrahydro-1H-indene;propane |
| SMILES | CCC.COC1CCC2C=CC=CC21.[Li+] |
| InChI | InChI=1S/C10H14O.C3H8.Li/c1-11-10-7-6-8-4-2-3-5-9(8)10;1-3-2;/h2-5,8-10H,6-7H2,1H3;3H2,1-2H3;/q;;+1 |
| InChIKey | RSDSNYPJDFSTQE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |