C18H18F4 — CID 176591706
(1R,7aR)-1-[(4-ethyl-2,3,5,6-tetrafluorophenyl)methyl]-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 176591706) has the molecular formula C18H18F4 and a molecular weight of 310.33 g/mol. Its IUPAC name is (1R,7aR)-1-[(4-ethyl-2,3,5,6-tetrafluorophenyl)methyl]-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | (1R,7aR)-1-[(4-ethyl-2,3,5,6-tetrafluorophenyl)methyl]-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 176591706 |
| Molecular Formula | C18H18F4 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (1R,7aR)-1-[(4-ethyl-2,3,5,6-tetrafluorophenyl)methyl]-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CCc1c(F)c(F)c(C[C@H]2CCC3C=CC=C[C@H]32)c(F)c1F |
| InChI | InChI=1S/C18H18F4/c1-2-12-15(19)17(21)14(18(22)16(12)20)9-11-8-7-10-5-3-4-6-13(10)11/h3-6,10-11,13H,2,7-9H2,1H3/t10?,11-,13-/m1/s1 |
| InChIKey | VDGQENFEFIUOHG-LIXJUXSLSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|