C20H28 — CID 142578265
1-[4-(6-methylcyclohexa-2,4-dien-1-yl)butyl]-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 142578265) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-[4-(6-methylcyclohexa-2,4-dien-1-yl)butyl]-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-[4-(6-methylcyclohexa-2,4-dien-1-yl)butyl]-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 142578265 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[4-(6-methylcyclohexa-2,4-dien-1-yl)butyl]-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC1C=CC=CC1CCCCC1CCC2C=CC=CC21 |
| InChI | InChI=1S/C20H28/c1-16-8-2-3-9-17(16)10-4-5-11-18-14-15-19-12-6-7-13-20(18)19/h2-3,6-9,12-13,16-20H,4-5,10-11,14-15H2,1H3 |
| InChIKey | ULJWHFZSFRUQMZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|