C9H12 — CID 14703991
7-methylbicyclo[4.2.0]octa-2,4-diene (PubChem CID 14703991) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is 7-methylbicyclo[4.2.0]octa-2,4-diene.
| Compound Name | 7-methylbicyclo[4.2.0]octa-2,4-diene |
|---|---|
| PubChem CID | 14703991 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 7-methylbicyclo[4.2.0]octa-2,4-diene |
| SMILES | CC1CC2C=CC=CC12 |
| InChI | InChI=1S/C9H12/c1-7-6-8-4-2-3-5-9(7)8/h2-5,7-9H,6H2,1H3 |
| InChIKey | AIVMHWDZNWCIMF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |