About tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene
tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene (PubChem CID 59047597) has the molecular formula C17H20
and a molecular weight of 224.35 g/mol. Its IUPAC name is tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene.
Analyze tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene?
The IUPAC name of tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene (CID 59047597) is tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene.
What is the SMILES notation for tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene?
The canonical SMILES for tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene is C1=CC2CC3CC(CC4C=CC=CC43)C2C=C1.
What is the InChIKey of tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene?
The InChIKey is CRBJGSUDNVZRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20/c1-3-7-16-12(5-1)9-14-11-15(16)10-13-6-2-4-8-17(13)14/h1-8,12-17H,9-11H2.
What are the key properties of tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene?
tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene has a molecular weight of 224.35 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[7.7.1.02,7.010,15]heptadeca-3,5,11,13-tetraene is sourced from PubChem (CID 59047597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).