C13H18 — CID 142195089
2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene (PubChem CID 142195089) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene.
| Compound Name | 2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene |
|---|---|
| PubChem CID | 142195089 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene |
| SMILES | C=CC1CC2C=CC=CC2CC1C |
| InChI | InChI=1S/C13H18/c1-3-11-9-13-7-5-4-6-12(13)8-10(11)2/h3-7,10-13H,1,8-9H2,2H3 |
| InChIKey | MPRKTULQZFTOBN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|